C22H26N2O5 — CID 135775658
8-[(2E)-2-[(2-hydroxy-4-phenylmethoxyphenyl)methylidene]hydrazinyl]-8-oxooctanoic acid (PubChem CID 135775658) has the molecular formula C22H26N2O5 and a molecular weight of 398.46 g/mol. Its IUPAC name is 8-[(2E)-2-[(2-hydroxy-4-phenylmethoxyphenyl)methylidene]hydrazinyl]-8-oxooctanoic acid.
| Compound Name | 8-[(2E)-2-[(2-hydroxy-4-phenylmethoxyphenyl)methylidene]hydrazinyl]-8-oxooctanoic acid |
|---|---|
| PubChem CID | 135775658 |
| Molecular Formula | C22H26N2O5 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | 8-[(2E)-2-[(2-hydroxy-4-phenylmethoxyphenyl)methylidene]hydrazinyl]-8-oxooctanoic acid |
| SMILES | O=C(O)CCCCCCC(=O)N/N=C/c1ccc(OCc2ccccc2)cc1O |
| InChI | InChI=1S/C22H26N2O5/c25-20-14-19(29-16-17-8-4-3-5-9-17)13-12-18(20)15-23-24-21(26)10-6-1-2-7-11-22(27)28/h3-5,8-9,12-15,25H,1-2,6-7,10-11,16H2,(H,24,26)(H,27,28)/b23-15+ |
| InChIKey | KCPYTULTVGLSHX-HZHRSRAPSA-N |
| XLogP | 3.85 |
| TPSA | 108.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|