C25H20N2O3S — CID 126150358
methyl (3R,4S)-5-cyano-6-(naphthalen-2-ylmethylsulfanyl)-2-oxo-4-phenyl-3,4-dihydro-1H-pyridine-3-carboxylate (PubChem CID 126150358) has the molecular formula C25H20N2O3S and a molecular weight of 428.51 g/mol. Its IUPAC name is methyl (3R,4S)-5-cyano-6-(naphthalen-2-ylmethylsulfanyl)-2-oxo-4-phenyl-3,4-dihydro-1H-pyridine-3-carboxylate.
| Compound Name | methyl (3R,4S)-5-cyano-6-(naphthalen-2-ylmethylsulfanyl)-2-oxo-4-phenyl-3,4-dihydro-1H-pyridine-3-carboxylate |
|---|---|
| PubChem CID | 126150358 |
| Molecular Formula | C25H20N2O3S |
| Molecular Weight | 428.51 g/mol |
| Exact Mass | 428.12 |
| IUPAC Name | methyl (3R,4S)-5-cyano-6-(naphthalen-2-ylmethylsulfanyl)-2-oxo-4-phenyl-3,4-dihydro-1H-pyridine-3-carboxylate |
| SMILES | COC(=O)[C@H]1C(=O)NC(SCc2ccc3ccccc3c2)=C(C#N)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C25H20N2O3S/c1-30-25(29)22-21(18-8-3-2-4-9-18)20(14-26)24(27-23(22)28)31-15-16-11-12-17-7-5-6-10-19(17)13-16/h2-13,21-22H,15H2,1H3,(H,27,28)/t21-,22+/m0/s1 |
| InChIKey | NXHXOBSSYGUQFY-FCHUYYIVSA-N |
| XLogP | 4.51 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.51 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|