C22H20N2O3S — CID 126155076
methyl (3R,4R)-5-cyano-2-oxo-4-phenyl-6-(2-phenylethylsulfanyl)-3,4-dihydro-1H-pyridine-3-carboxylate (PubChem CID 126155076) has the molecular formula C22H20N2O3S and a molecular weight of 392.48 g/mol. Its IUPAC name is methyl (3R,4R)-5-cyano-2-oxo-4-phenyl-6-(2-phenylethylsulfanyl)-3,4-dihydro-1H-pyridine-3-carboxylate.
| Compound Name | methyl (3R,4R)-5-cyano-2-oxo-4-phenyl-6-(2-phenylethylsulfanyl)-3,4-dihydro-1H-pyridine-3-carboxylate |
|---|---|
| PubChem CID | 126155076 |
| Molecular Formula | C22H20N2O3S |
| Molecular Weight | 392.48 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | methyl (3R,4R)-5-cyano-2-oxo-4-phenyl-6-(2-phenylethylsulfanyl)-3,4-dihydro-1H-pyridine-3-carboxylate |
| SMILES | COC(=O)[C@H]1C(=O)NC(SCCc2ccccc2)=C(C#N)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C22H20N2O3S/c1-27-22(26)19-18(16-10-6-3-7-11-16)17(14-23)21(24-20(19)25)28-13-12-15-8-4-2-5-9-15/h2-11,18-19H,12-13H2,1H3,(H,24,25)/t18-,19-/m1/s1 |
| InChIKey | RTNMZDDMBDXKSU-RTBURBONSA-N |
| XLogP | 3.40 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.48 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|