C27H23IN2O2S — CID 126152905
(2R)-2-[3-ethoxy-5-iodo-4-(naphthalen-1-ylmethoxy)phenyl]-5-phenyl-2,3-dihydro-1,3,4-thiadiazole (PubChem CID 126152905) has the molecular formula C27H23IN2O2S and a molecular weight of 566.46 g/mol. Its IUPAC name is (2R)-2-[3-ethoxy-5-iodo-4-(naphthalen-1-ylmethoxy)phenyl]-5-phenyl-2,3-dihydro-1,3,4-thiadiazole.
| Compound Name | (2R)-2-[3-ethoxy-5-iodo-4-(naphthalen-1-ylmethoxy)phenyl]-5-phenyl-2,3-dihydro-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 126152905 |
| Molecular Formula | C27H23IN2O2S |
| Molecular Weight | 566.46 g/mol |
| Exact Mass | 566.05 |
| IUPAC Name | (2R)-2-[3-ethoxy-5-iodo-4-(naphthalen-1-ylmethoxy)phenyl]-5-phenyl-2,3-dihydro-1,3,4-thiadiazole |
| SMILES | CCOc1cc([C@@H]2NN=C(c3ccccc3)S2)cc(I)c1OCc1cccc2ccccc12 |
| InChI | InChI=1S/C27H23IN2O2S/c1-2-31-24-16-21(27-30-29-26(33-27)19-10-4-3-5-11-19)15-23(28)25(24)32-17-20-13-8-12-18-9-6-7-14-22(18)20/h3-16,27,30H,2,17H2,1H3/t27-/m1/s1 |
| InChIKey | UJZKXRSWLNCAQK-HHHXNRCGSA-N |
| XLogP | 7.12 |
| TPSA | 42.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.46 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|