C18H13BrFNO4S — CID 126152945
(5R)-5-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-3-[(4-fluorophenyl)methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 126152945) has the molecular formula C18H13BrFNO4S and a molecular weight of 438.27 g/mol. Its IUPAC name is (5R)-5-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-3-[(4-fluorophenyl)methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5R)-5-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-3-[(4-fluorophenyl)methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126152945 |
| Molecular Formula | C18H13BrFNO4S |
| Molecular Weight | 438.27 g/mol |
| Exact Mass | 436.97 |
| IUPAC Name | (5R)-5-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-3-[(4-fluorophenyl)methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1S[C@H](Cc2cc3c(cc2Br)OCO3)C(=O)N1Cc1ccc(F)cc1 |
| InChI | InChI=1S/C18H13BrFNO4S/c19-13-7-15-14(24-9-25-15)5-11(13)6-16-17(22)21(18(23)26-16)8-10-1-3-12(20)4-2-10/h1-5,7,16H,6,8-9H2/t16-/m1/s1 |
| InChIKey | USEZPUDFBQNABB-MRXNPFEDSA-N |
| XLogP | 4.12 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.27 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|