C6H8O4 — CID 12615322
2,3-dimethoxy-2H-furan-5-one (PubChem CID 12615322) has the molecular formula C6H8O4 and a molecular weight of 144.13 g/mol. Its IUPAC name is 2,3-dimethoxy-2H-furan-5-one.
| Compound Name | 2,3-dimethoxy-2H-furan-5-one |
|---|---|
| PubChem CID | 12615322 |
| Molecular Formula | C6H8O4 |
| Molecular Weight | 144.13 g/mol |
| Exact Mass | 144.04 |
| IUPAC Name | 2,3-dimethoxy-2H-furan-5-one |
| SMILES | COC1=CC(=O)OC1OC |
| InChI | InChI=1S/C6H8O4/c1-8-4-3-5(7)10-6(4)9-2/h3,6H,1-2H3 |
| InChIKey | LMUKQORUKXNSBX-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.13 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |