C19H14BrN3O5 — CID 126153717
(2R)-N-[(Z)-[5-(4-bromo-2-nitrophenyl)furan-2-yl]methylideneamino]-2-hydroxy-2-phenylacetamide (PubChem CID 126153717) has the molecular formula C19H14BrN3O5 and a molecular weight of 444.24 g/mol. Its IUPAC name is (2R)-N-[(Z)-[5-(4-bromo-2-nitrophenyl)furan-2-yl]methylideneamino]-2-hydroxy-2-phenylacetamide.
| Compound Name | (2R)-N-[(Z)-[5-(4-bromo-2-nitrophenyl)furan-2-yl]methylideneamino]-2-hydroxy-2-phenylacetamide |
|---|---|
| PubChem CID | 126153717 |
| Molecular Formula | C19H14BrN3O5 |
| Molecular Weight | 444.24 g/mol |
| Exact Mass | 443.01 |
| IUPAC Name | (2R)-N-[(Z)-[5-(4-bromo-2-nitrophenyl)furan-2-yl]methylideneamino]-2-hydroxy-2-phenylacetamide |
| SMILES | O=C(N/N=C\c1ccc(-c2ccc(Br)cc2[N+](=O)[O-])o1)[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C19H14BrN3O5/c20-13-6-8-15(16(10-13)23(26)27)17-9-7-14(28-17)11-21-22-19(25)18(24)12-4-2-1-3-5-12/h1-11,18,24H,(H,22,25)/b21-11-/t18-/m1/s1 |
| InChIKey | XUQABNOGHMFFGU-UTYYKHSJSA-N |
| XLogP | 3.80 |
| TPSA | 117.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.24 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|