C26H29N3O5S — CID 126153930
N-[(Z)-(3-methoxy-4-phenylmethoxyphenyl)methylideneamino]-2-[(2,4,6-trimethylphenyl)sulfonylamino]acetamide (PubChem CID 126153930) has the molecular formula C26H29N3O5S and a molecular weight of 495.60 g/mol. Its IUPAC name is N-[(Z)-(3-methoxy-4-phenylmethoxyphenyl)methylideneamino]-2-[(2,4,6-trimethylphenyl)sulfonylamino]acetamide.
| Compound Name | N-[(Z)-(3-methoxy-4-phenylmethoxyphenyl)methylideneamino]-2-[(2,4,6-trimethylphenyl)sulfonylamino]acetamide |
|---|---|
| PubChem CID | 126153930 |
| Molecular Formula | C26H29N3O5S |
| Molecular Weight | 495.60 g/mol |
| Exact Mass | 495.18 |
| IUPAC Name | N-[(Z)-(3-methoxy-4-phenylmethoxyphenyl)methylideneamino]-2-[(2,4,6-trimethylphenyl)sulfonylamino]acetamide |
| SMILES | COc1cc(/C=N\NC(=O)CNS(=O)(=O)c2c(C)cc(C)cc2C)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C26H29N3O5S/c1-18-12-19(2)26(20(3)13-18)35(31,32)28-16-25(30)29-27-15-22-10-11-23(24(14-22)33-4)34-17-21-8-6-5-7-9-21/h5-15,28H,16-17H2,1-4H3,(H,29,30)/b27-15- |
| InChIKey | ZAAUUGQYDSKHCD-DICXZTSXSA-N |
| XLogP | 3.63 |
| TPSA | 106.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.60 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|