C8H13N3S — CID 12615428
4-cyclohexyl-1H-1,2,4-triazole-5-thione (PubChem CID 12615428) has the molecular formula C8H13N3S and a molecular weight of 183.28 g/mol. Its IUPAC name is 4-cyclohexyl-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-cyclohexyl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 12615428 |
| Molecular Formula | C8H13N3S |
| Molecular Weight | 183.28 g/mol |
| Exact Mass | 183.08 |
| IUPAC Name | 4-cyclohexyl-1H-1,2,4-triazole-5-thione |
| SMILES | S=c1[nH]ncn1C1CCCCC1 |
| InChI | InChI=1S/C8H13N3S/c12-8-10-9-6-11(8)7-4-2-1-3-5-7/h6-7H,1-5H2,(H,10,12) |
| InChIKey | QOZAIVBUQXWUHB-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 33.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.28 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|