C22H25N5O3S — CID 126162398
N-[[4-ethyl-1-[2-(3-methoxyanilino)-2-oxoethyl]-5-sulfanylidene-1,2,4-triazol-3-yl]methyl]-2-methylbenzamide (PubChem CID 126162398) has the molecular formula C22H25N5O3S and a molecular weight of 439.54 g/mol. Its IUPAC name is N-[[4-ethyl-1-[2-(3-methoxyanilino)-2-oxoethyl]-5-sulfanylidene-1,2,4-triazol-3-yl]methyl]-2-methylbenzamide.
| Compound Name | N-[[4-ethyl-1-[2-(3-methoxyanilino)-2-oxoethyl]-5-sulfanylidene-1,2,4-triazol-3-yl]methyl]-2-methylbenzamide |
|---|---|
| PubChem CID | 126162398 |
| Molecular Formula | C22H25N5O3S |
| Molecular Weight | 439.54 g/mol |
| Exact Mass | 439.17 |
| IUPAC Name | N-[[4-ethyl-1-[2-(3-methoxyanilino)-2-oxoethyl]-5-sulfanylidene-1,2,4-triazol-3-yl]methyl]-2-methylbenzamide |
| SMILES | CCn1c(CNC(=O)c2ccccc2C)nn(CC(=O)Nc2cccc(OC)c2)c1=S |
| InChI | InChI=1S/C22H25N5O3S/c1-4-26-19(13-23-21(29)18-11-6-5-8-15(18)2)25-27(22(26)31)14-20(28)24-16-9-7-10-17(12-16)30-3/h5-12H,4,13-14H2,1-3H3,(H,23,29)(H,24,28) |
| InChIKey | RUHSRZLZQYVZBR-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 90.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.54 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|