C21H22FN5O2S — CID 126182525
N-[[4-ethyl-1-[2-(2-fluoroanilino)-2-oxoethyl]-5-sulfanylidene-1,2,4-triazol-3-yl]methyl]-2-methylbenzamide (PubChem CID 126182525) has the molecular formula C21H22FN5O2S and a molecular weight of 427.51 g/mol. Its IUPAC name is N-[[4-ethyl-1-[2-(2-fluoroanilino)-2-oxoethyl]-5-sulfanylidene-1,2,4-triazol-3-yl]methyl]-2-methylbenzamide.
| Compound Name | N-[[4-ethyl-1-[2-(2-fluoroanilino)-2-oxoethyl]-5-sulfanylidene-1,2,4-triazol-3-yl]methyl]-2-methylbenzamide |
|---|---|
| PubChem CID | 126182525 |
| Molecular Formula | C21H22FN5O2S |
| Molecular Weight | 427.51 g/mol |
| Exact Mass | 427.15 |
| IUPAC Name | N-[[4-ethyl-1-[2-(2-fluoroanilino)-2-oxoethyl]-5-sulfanylidene-1,2,4-triazol-3-yl]methyl]-2-methylbenzamide |
| SMILES | CCn1c(CNC(=O)c2ccccc2C)nn(CC(=O)Nc2ccccc2F)c1=S |
| InChI | InChI=1S/C21H22FN5O2S/c1-3-26-18(12-23-20(29)15-9-5-4-8-14(15)2)25-27(21(26)30)13-19(28)24-17-11-7-6-10-16(17)22/h4-11H,3,12-13H2,1-2H3,(H,23,29)(H,24,28) |
| InChIKey | ZEFSOSGVWPJTPH-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 80.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.51 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|