C24H23N7O4S2 — CID 126167240
N-[[4-ethyl-1-[2-[[4-(3-nitrophenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl]-5-sulfanylidene-1,2,4-triazol-3-yl]methyl]-2-methylbenzamide (PubChem CID 126167240) has the molecular formula C24H23N7O4S2 and a molecular weight of 537.63 g/mol. Its IUPAC name is N-[[4-ethyl-1-[2-[[4-(3-nitrophenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl]-5-sulfanylidene-1,2,4-triazol-3-yl]methyl]-2-methylbenzamide.
| Compound Name | N-[[4-ethyl-1-[2-[[4-(3-nitrophenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl]-5-sulfanylidene-1,2,4-triazol-3-yl]methyl]-2-methylbenzamide |
|---|---|
| PubChem CID | 126167240 |
| Molecular Formula | C24H23N7O4S2 |
| Molecular Weight | 537.63 g/mol |
| Exact Mass | 537.13 |
| IUPAC Name | N-[[4-ethyl-1-[2-[[4-(3-nitrophenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl]-5-sulfanylidene-1,2,4-triazol-3-yl]methyl]-2-methylbenzamide |
| SMILES | CCn1c(CNC(=O)c2ccccc2C)nn(CC(=O)Nc2nc(-c3cccc([N+](=O)[O-])c3)cs2)c1=S |
| InChI | InChI=1S/C24H23N7O4S2/c1-3-29-20(12-25-22(33)18-10-5-4-7-15(18)2)28-30(24(29)36)13-21(32)27-23-26-19(14-37-23)16-8-6-9-17(11-16)31(34)35/h4-11,14H,3,12-13H2,1-2H3,(H,25,33)(H,26,27,32) |
| InChIKey | RQFHXSUYHSMDMG-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 136.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.63 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|