C22H24BrN3O3 — CID 126164758
(3S)-1-(4-bromophenyl)-N-[(Z)-(4-butoxyphenyl)methylideneamino]-5-oxopyrrolidine-3-carboxamide (PubChem CID 126164758) has the molecular formula C22H24BrN3O3 and a molecular weight of 458.36 g/mol. Its IUPAC name is (3S)-1-(4-bromophenyl)-N-[(Z)-(4-butoxyphenyl)methylideneamino]-5-oxopyrrolidine-3-carboxamide.
| Compound Name | (3S)-1-(4-bromophenyl)-N-[(Z)-(4-butoxyphenyl)methylideneamino]-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 126164758 |
| Molecular Formula | C22H24BrN3O3 |
| Molecular Weight | 458.36 g/mol |
| Exact Mass | 457.10 |
| IUPAC Name | (3S)-1-(4-bromophenyl)-N-[(Z)-(4-butoxyphenyl)methylideneamino]-5-oxopyrrolidine-3-carboxamide |
| SMILES | CCCCOc1ccc(/C=N\NC(=O)[C@H]2CC(=O)N(c3ccc(Br)cc3)C2)cc1 |
| InChI | InChI=1S/C22H24BrN3O3/c1-2-3-12-29-20-10-4-16(5-11-20)14-24-25-22(28)17-13-21(27)26(15-17)19-8-6-18(23)7-9-19/h4-11,14,17H,2-3,12-13,15H2,1H3,(H,25,28)/b24-14-/t17-/m0/s1 |
| InChIKey | XMRKTGYATWCPHZ-PDESAOGPSA-N |
| XLogP | 4.13 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.36 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|