C21H18N2O5S — CID 126165286
methyl 4-[(E)-[3-[2-(2-methylanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]benzoate (PubChem CID 126165286) has the molecular formula C21H18N2O5S and a molecular weight of 410.45 g/mol. Its IUPAC name is methyl 4-[(E)-[3-[2-(2-methylanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]benzoate.
| Compound Name | methyl 4-[(E)-[3-[2-(2-methylanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]benzoate |
|---|---|
| PubChem CID | 126165286 |
| Molecular Formula | C21H18N2O5S |
| Molecular Weight | 410.45 g/mol |
| Exact Mass | 410.09 |
| IUPAC Name | methyl 4-[(E)-[3-[2-(2-methylanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]benzoate |
| SMILES | COC(=O)c1ccc(/C=C2/SC(=O)N(CC(=O)Nc3ccccc3C)C2=O)cc1 |
| InChI | InChI=1S/C21H18N2O5S/c1-13-5-3-4-6-16(13)22-18(24)12-23-19(25)17(29-21(23)27)11-14-7-9-15(10-8-14)20(26)28-2/h3-11H,12H2,1-2H3,(H,22,24)/b17-11+ |
| InChIKey | PUBUXKCGMPEJNV-GZTJUZNOSA-N |
| XLogP | 3.46 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.45 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|