C23H19N3O3S — CID 50855450
2-[(5E)-2,4-dioxo-5-[(1-phenylpyrrol-3-yl)methylidene]-1,3-thiazolidin-3-yl]-N-(2-methylphenyl)acetamide (PubChem CID 50855450) has the molecular formula C23H19N3O3S and a molecular weight of 417.49 g/mol. Its IUPAC name is 2-[(5E)-2,4-dioxo-5-[(1-phenylpyrrol-3-yl)methylidene]-1,3-thiazolidin-3-yl]-N-(2-methylphenyl)acetamide.
| Compound Name | 2-[(5E)-2,4-dioxo-5-[(1-phenylpyrrol-3-yl)methylidene]-1,3-thiazolidin-3-yl]-N-(2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 50855450 |
| Molecular Formula | C23H19N3O3S |
| Molecular Weight | 417.49 g/mol |
| Exact Mass | 417.11 |
| IUPAC Name | 2-[(5E)-2,4-dioxo-5-[(1-phenylpyrrol-3-yl)methylidene]-1,3-thiazolidin-3-yl]-N-(2-methylphenyl)acetamide |
| SMILES | Cc1ccccc1NC(=O)CN1C(=O)S/C(=C/c2ccn(-c3ccccc3)c2)C1=O |
| InChI | InChI=1S/C23H19N3O3S/c1-16-7-5-6-10-19(16)24-21(27)15-26-22(28)20(30-23(26)29)13-17-11-12-25(14-17)18-8-3-2-4-9-18/h2-14H,15H2,1H3,(H,24,27)/b20-13+ |
| InChIKey | UFKAQUQGUFQPIF-DEDYPNTBSA-N |
| XLogP | 4.46 |
| TPSA | 71.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.49 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|