C23H18BrN3O3S — CID 126024367
2-[(5Z)-5-[[1-(3-bromophenyl)pyrrol-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2-methylphenyl)acetamide (PubChem CID 126024367) has the molecular formula C23H18BrN3O3S and a molecular weight of 496.39 g/mol. Its IUPAC name is 2-[(5Z)-5-[[1-(3-bromophenyl)pyrrol-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2-methylphenyl)acetamide.
| Compound Name | 2-[(5Z)-5-[[1-(3-bromophenyl)pyrrol-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 126024367 |
| Molecular Formula | C23H18BrN3O3S |
| Molecular Weight | 496.39 g/mol |
| Exact Mass | 495.03 |
| IUPAC Name | 2-[(5Z)-5-[[1-(3-bromophenyl)pyrrol-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2-methylphenyl)acetamide |
| SMILES | Cc1ccccc1NC(=O)CN1C(=O)S/C(=C\c2cccn2-c2cccc(Br)c2)C1=O |
| InChI | InChI=1S/C23H18BrN3O3S/c1-15-6-2-3-10-19(15)25-21(28)14-27-22(29)20(31-23(27)30)13-18-9-5-11-26(18)17-8-4-7-16(24)12-17/h2-13H,14H2,1H3,(H,25,28)/b20-13- |
| InChIKey | FZJDAPGJBHJKMG-MOSHPQCFSA-N |
| XLogP | 5.22 |
| TPSA | 71.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.39 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|