C24H20ClN3O3S — CID 126020889
2-[(5Z)-5-[[1-(3-chloro-4-methylphenyl)pyrrol-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2-methylphenyl)acetamide (PubChem CID 126020889) has the molecular formula C24H20ClN3O3S and a molecular weight of 465.96 g/mol. Its IUPAC name is 2-[(5Z)-5-[[1-(3-chloro-4-methylphenyl)pyrrol-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2-methylphenyl)acetamide.
| Compound Name | 2-[(5Z)-5-[[1-(3-chloro-4-methylphenyl)pyrrol-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 126020889 |
| Molecular Formula | C24H20ClN3O3S |
| Molecular Weight | 465.96 g/mol |
| Exact Mass | 465.09 |
| IUPAC Name | 2-[(5Z)-5-[[1-(3-chloro-4-methylphenyl)pyrrol-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2-methylphenyl)acetamide |
| SMILES | Cc1ccc(-n2cccc2/C=C2\SC(=O)N(CC(=O)Nc3ccccc3C)C2=O)cc1Cl |
| InChI | InChI=1S/C24H20ClN3O3S/c1-15-9-10-18(12-19(15)25)27-11-5-7-17(27)13-21-23(30)28(24(31)32-21)14-22(29)26-20-8-4-3-6-16(20)2/h3-13H,14H2,1-2H3,(H,26,29)/b21-13- |
| InChIKey | WZWKKJDKTHZHDU-BKUYFWCQSA-N |
| XLogP | 5.42 |
| TPSA | 71.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.96 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|