C22H16ClN3O4S — CID 126028277
N-(3-chlorophenyl)-2-[(5Z)-5-[[1-(4-hydroxyphenyl)pyrrol-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide (PubChem CID 126028277) has the molecular formula C22H16ClN3O4S and a molecular weight of 453.91 g/mol. Its IUPAC name is N-(3-chlorophenyl)-2-[(5Z)-5-[[1-(4-hydroxyphenyl)pyrrol-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide.
| Compound Name | N-(3-chlorophenyl)-2-[(5Z)-5-[[1-(4-hydroxyphenyl)pyrrol-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide |
|---|---|
| PubChem CID | 126028277 |
| Molecular Formula | C22H16ClN3O4S |
| Molecular Weight | 453.91 g/mol |
| Exact Mass | 453.06 |
| IUPAC Name | N-(3-chlorophenyl)-2-[(5Z)-5-[[1-(4-hydroxyphenyl)pyrrol-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide |
| SMILES | O=C(CN1C(=O)S/C(=C\c2cccn2-c2ccc(O)cc2)C1=O)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C22H16ClN3O4S/c23-14-3-1-4-15(11-14)24-20(28)13-26-21(29)19(31-22(26)30)12-17-5-2-10-25(17)16-6-8-18(27)9-7-16/h1-12,27H,13H2,(H,24,28)/b19-12- |
| InChIKey | UBYHHJAHLILQHI-UNOMPAQXSA-N |
| XLogP | 4.51 |
| TPSA | 91.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.91 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|