C20H19F2N — CID 126165928
(3aS,4R,9bR)-4-(4-ethylphenyl)-6,8-difluoro-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline (PubChem CID 126165928) has the molecular formula C20H19F2N and a molecular weight of 311.38 g/mol. Its IUPAC name is (3aS,4R,9bR)-4-(4-ethylphenyl)-6,8-difluoro-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline.
| Compound Name | (3aS,4R,9bR)-4-(4-ethylphenyl)-6,8-difluoro-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
|---|---|
| PubChem CID | 126165928 |
| Molecular Formula | C20H19F2N |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.15 |
| IUPAC Name | (3aS,4R,9bR)-4-(4-ethylphenyl)-6,8-difluoro-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
| SMILES | CCc1ccc([C@@H]2Nc3c(F)cc(F)cc3[C@@H]3C=CC[C@@H]32)cc1 |
| InChI | InChI=1S/C20H19F2N/c1-2-12-6-8-13(9-7-12)19-16-5-3-4-15(16)17-10-14(21)11-18(22)20(17)23-19/h3-4,6-11,15-16,19,23H,2,5H2,1H3/t15-,16+,19+/m1/s1 |
| InChIKey | VZKRWALCHFVEAE-GJYPPUQNSA-N |
| XLogP | 5.35 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|