C35H35N3O3S — CID 126173071
(1S,2R,10R,11R,12S)-N-[4-[(2,6-dimethylphenyl)sulfamoyl]phenyl]-10-phenyl-9-azatetracyclo[10.2.1.02,11.03,8]pentadeca-3(8),4,6-triene-5-carboxamide (PubChem CID 126173071) has the molecular formula C35H35N3O3S and a molecular weight of 577.75 g/mol. Its IUPAC name is (1S,2R,10R,11R,12S)-N-[4-[(2,6-dimethylphenyl)sulfamoyl]phenyl]-10-phenyl-9-azatetracyclo[10.2.1.02,11.03,8]pentadeca-3(8),4,6-triene-5-carboxamide.
| Compound Name | (1S,2R,10R,11R,12S)-N-[4-[(2,6-dimethylphenyl)sulfamoyl]phenyl]-10-phenyl-9-azatetracyclo[10.2.1.02,11.03,8]pentadeca-3(8),4,6-triene-5-carboxamide |
|---|---|
| PubChem CID | 126173071 |
| Molecular Formula | C35H35N3O3S |
| Molecular Weight | 577.75 g/mol |
| Exact Mass | 577.24 |
| IUPAC Name | (1S,2R,10R,11R,12S)-N-[4-[(2,6-dimethylphenyl)sulfamoyl]phenyl]-10-phenyl-9-azatetracyclo[10.2.1.02,11.03,8]pentadeca-3(8),4,6-triene-5-carboxamide |
| SMILES | Cc1cccc(C)c1NS(=O)(=O)c1ccc(NC(=O)c2ccc3c(c2)[C@@H]2[C@H]4CC[C@@H](C4)[C@H]2[C@H](c2ccccc2)N3)cc1 |
| InChI | InChI=1S/C35H35N3O3S/c1-21-7-6-8-22(2)33(21)38-42(40,41)28-16-14-27(15-17-28)36-35(39)26-13-18-30-29(20-26)31-24-11-12-25(19-24)32(31)34(37-30)23-9-4-3-5-10-23/h3-10,13-18,20,24-25,31-32,34,37-38H,11-12,19H2,1-2H3,(H,36,39)/t24-,25-,31-,32+,34-/m0/s1 |
| InChIKey | GTVYQZCXWGDNGV-ITNNODMQSA-N |
| XLogP | 7.65 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.75 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |