C34H33N3O3S — CID 126188816
(1S,2R,10S,11R,12S)-N-[4-[(4-methylphenyl)sulfamoyl]phenyl]-10-phenyl-9-azatetracyclo[10.2.1.02,11.03,8]pentadeca-3(8),4,6-triene-5-carboxamide (PubChem CID 126188816) has the molecular formula C34H33N3O3S and a molecular weight of 563.72 g/mol. Its IUPAC name is (1S,2R,10S,11R,12S)-N-[4-[(4-methylphenyl)sulfamoyl]phenyl]-10-phenyl-9-azatetracyclo[10.2.1.02,11.03,8]pentadeca-3(8),4,6-triene-5-carboxamide.
| Compound Name | (1S,2R,10S,11R,12S)-N-[4-[(4-methylphenyl)sulfamoyl]phenyl]-10-phenyl-9-azatetracyclo[10.2.1.02,11.03,8]pentadeca-3(8),4,6-triene-5-carboxamide |
|---|---|
| PubChem CID | 126188816 |
| Molecular Formula | C34H33N3O3S |
| Molecular Weight | 563.72 g/mol |
| Exact Mass | 563.22 |
| IUPAC Name | (1S,2R,10S,11R,12S)-N-[4-[(4-methylphenyl)sulfamoyl]phenyl]-10-phenyl-9-azatetracyclo[10.2.1.02,11.03,8]pentadeca-3(8),4,6-triene-5-carboxamide |
| SMILES | Cc1ccc(NS(=O)(=O)c2ccc(NC(=O)c3ccc4c(c3)[C@@H]3[C@H]5CC[C@@H](C5)[C@H]3[C@@H](c3ccccc3)N4)cc2)cc1 |
| InChI | InChI=1S/C34H33N3O3S/c1-21-7-12-27(13-8-21)37-41(39,40)28-16-14-26(15-17-28)35-34(38)25-11-18-30-29(20-25)31-23-9-10-24(19-23)32(31)33(36-30)22-5-3-2-4-6-22/h2-8,11-18,20,23-24,31-33,36-37H,9-10,19H2,1H3,(H,35,38)/t23-,24-,31-,32+,33+/m0/s1 |
| InChIKey | MJQXRFUGHZHUJS-IYYQOIGVSA-N |
| XLogP | 7.34 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.72 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |