C31H23Cl2N3O3S — CID 126179636
2-[[(5E)-5-[[1-[4-[(2,4-dichlorophenyl)methoxy]phenyl]-2,5-dimethylpyrrol-3-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]benzonitrile (PubChem CID 126179636) has the molecular formula C31H23Cl2N3O3S and a molecular weight of 588.52 g/mol. Its IUPAC name is 2-[[(5E)-5-[[1-[4-[(2,4-dichlorophenyl)methoxy]phenyl]-2,5-dimethylpyrrol-3-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]benzonitrile.
| Compound Name | 2-[[(5E)-5-[[1-[4-[(2,4-dichlorophenyl)methoxy]phenyl]-2,5-dimethylpyrrol-3-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 126179636 |
| Molecular Formula | C31H23Cl2N3O3S |
| Molecular Weight | 588.52 g/mol |
| Exact Mass | 587.08 |
| IUPAC Name | 2-[[(5E)-5-[[1-[4-[(2,4-dichlorophenyl)methoxy]phenyl]-2,5-dimethylpyrrol-3-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]benzonitrile |
| SMILES | Cc1cc(/C=C2/SC(=O)N(Cc3ccccc3C#N)C2=O)c(C)n1-c1ccc(OCc2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C31H23Cl2N3O3S/c1-19-13-24(14-29-30(37)35(31(38)40-29)17-22-6-4-3-5-21(22)16-34)20(2)36(19)26-9-11-27(12-10-26)39-18-23-7-8-25(32)15-28(23)33/h3-15H,17-18H2,1-2H3/b29-14+ |
| InChIKey | PLTIDSLDEJZNGC-IPPBACCNSA-N |
| XLogP | 8.09 |
| TPSA | 75.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.52 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|