C30H23Cl2N3O5S — CID 6519774
(5E)-5-[[1-[4-[(2,4-dichlorophenyl)methoxy]phenyl]-2,5-dimethylpyrrol-3-yl]methylidene]-3-[(3-nitrophenyl)methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 6519774) has the molecular formula C30H23Cl2N3O5S and a molecular weight of 608.50 g/mol. Its IUPAC name is (5E)-5-[[1-[4-[(2,4-dichlorophenyl)methoxy]phenyl]-2,5-dimethylpyrrol-3-yl]methylidene]-3-[(3-nitrophenyl)methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[[1-[4-[(2,4-dichlorophenyl)methoxy]phenyl]-2,5-dimethylpyrrol-3-yl]methylidene]-3-[(3-nitrophenyl)methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 6519774 |
| Molecular Formula | C30H23Cl2N3O5S |
| Molecular Weight | 608.50 g/mol |
| Exact Mass | 607.07 |
| IUPAC Name | (5E)-5-[[1-[4-[(2,4-dichlorophenyl)methoxy]phenyl]-2,5-dimethylpyrrol-3-yl]methylidene]-3-[(3-nitrophenyl)methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | Cc1cc(/C=C2/SC(=O)N(Cc3cccc([N+](=O)[O-])c3)C2=O)c(C)n1-c1ccc(OCc2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C30H23Cl2N3O5S/c1-18-12-22(14-28-29(36)33(30(37)41-28)16-20-4-3-5-25(13-20)35(38)39)19(2)34(18)24-8-10-26(11-9-24)40-17-21-6-7-23(31)15-27(21)32/h3-15H,16-17H2,1-2H3/b28-14+ |
| InChIKey | AUPPWJMHTAPXRJ-CCVNUDIWSA-N |
| XLogP | 8.12 |
| TPSA | 94.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.50 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|