C20H22BrNO2S2 — CID 126180700
N-[4-(2-adamantyl)phenyl]-5-bromothiophene-2-sulfonamide (PubChem CID 126180700) has the molecular formula C20H22BrNO2S2 and a molecular weight of 452.44 g/mol. Its IUPAC name is N-[4-(2-adamantyl)phenyl]-5-bromothiophene-2-sulfonamide.
| Compound Name | N-[4-(2-adamantyl)phenyl]-5-bromothiophene-2-sulfonamide |
|---|---|
| PubChem CID | 126180700 |
| Molecular Formula | C20H22BrNO2S2 |
| Molecular Weight | 452.44 g/mol |
| Exact Mass | 451.03 |
| IUPAC Name | N-[4-(2-adamantyl)phenyl]-5-bromothiophene-2-sulfonamide |
| SMILES | O=S(=O)(Nc1ccc(C2C3CC4CC(C3)CC2C4)cc1)c1ccc(Br)s1 |
| InChI | InChI=1S/C20H22BrNO2S2/c21-18-5-6-19(25-18)26(23,24)22-17-3-1-14(2-4-17)20-15-8-12-7-13(10-15)11-16(20)9-12/h1-6,12-13,15-16,20,22H,7-11H2 |
| InChIKey | SUARMASSZZZSOB-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.44 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |