C25H21Cl2NS — CID 126180951
(3aS,4R,9bS)-4-(3,4-dichlorophenyl)-8-(phenylsulfanylmethyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline (PubChem CID 126180951) has the molecular formula C25H21Cl2NS and a molecular weight of 438.42 g/mol. Its IUPAC name is (3aS,4R,9bS)-4-(3,4-dichlorophenyl)-8-(phenylsulfanylmethyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline.
| Compound Name | (3aS,4R,9bS)-4-(3,4-dichlorophenyl)-8-(phenylsulfanylmethyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
|---|---|
| PubChem CID | 126180951 |
| Molecular Formula | C25H21Cl2NS |
| Molecular Weight | 438.42 g/mol |
| Exact Mass | 437.08 |
| IUPAC Name | (3aS,4R,9bS)-4-(3,4-dichlorophenyl)-8-(phenylsulfanylmethyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
| SMILES | Clc1ccc([C@@H]2Nc3ccc(CSc4ccccc4)cc3[C@H]3C=CC[C@@H]32)cc1Cl |
| InChI | InChI=1S/C25H21Cl2NS/c26-22-11-10-17(14-23(22)27)25-20-8-4-7-19(20)21-13-16(9-12-24(21)28-25)15-29-18-5-2-1-3-6-18/h1-7,9-14,19-20,25,28H,8,15H2/t19-,20-,25-/m0/s1 |
| InChIKey | NTEVBSSRYWXJPH-RLSLOFABSA-N |
| XLogP | 8.11 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.42 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|