C26H24ClNS — CID 126164162
(3aR,4S,9bR)-4-(4-chlorophenyl)-6-methyl-8-(phenylsulfanylmethyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline (PubChem CID 126164162) has the molecular formula C26H24ClNS and a molecular weight of 418.01 g/mol. Its IUPAC name is (3aR,4S,9bR)-4-(4-chlorophenyl)-6-methyl-8-(phenylsulfanylmethyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline.
| Compound Name | (3aR,4S,9bR)-4-(4-chlorophenyl)-6-methyl-8-(phenylsulfanylmethyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
|---|---|
| PubChem CID | 126164162 |
| Molecular Formula | C26H24ClNS |
| Molecular Weight | 418.01 g/mol |
| Exact Mass | 417.13 |
| IUPAC Name | (3aR,4S,9bR)-4-(4-chlorophenyl)-6-methyl-8-(phenylsulfanylmethyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
| SMILES | Cc1cc(CSc2ccccc2)cc2c1N[C@H](c1ccc(Cl)cc1)[C@@H]1CC=C[C@@H]21 |
| InChI | InChI=1S/C26H24ClNS/c1-17-14-18(16-29-21-6-3-2-4-7-21)15-24-22-8-5-9-23(22)26(28-25(17)24)19-10-12-20(27)13-11-19/h2-8,10-15,22-23,26,28H,9,16H2,1H3/t22-,23-,26-/m1/s1 |
| InChIKey | QLXNZCCFGOZVSM-JQYIIUTOSA-N |
| XLogP | 7.77 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.01 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|