C27H25NO2S — CID 126160809
2-[(3aR,4S,9bS)-6-methyl-8-(phenylsulfanylmethyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl]benzoic acid (PubChem CID 126160809) has the molecular formula C27H25NO2S and a molecular weight of 427.57 g/mol. Its IUPAC name is 2-[(3aR,4S,9bS)-6-methyl-8-(phenylsulfanylmethyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl]benzoic acid.
| Compound Name | 2-[(3aR,4S,9bS)-6-methyl-8-(phenylsulfanylmethyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl]benzoic acid |
|---|---|
| PubChem CID | 126160809 |
| Molecular Formula | C27H25NO2S |
| Molecular Weight | 427.57 g/mol |
| Exact Mass | 427.16 |
| IUPAC Name | 2-[(3aR,4S,9bS)-6-methyl-8-(phenylsulfanylmethyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl]benzoic acid |
| SMILES | Cc1cc(CSc2ccccc2)cc2c1N[C@H](c1ccccc1C(=O)O)[C@@H]1CC=C[C@H]21 |
| InChI | InChI=1S/C27H25NO2S/c1-17-14-18(16-31-19-8-3-2-4-9-19)15-24-20-12-7-13-21(20)26(28-25(17)24)22-10-5-6-11-23(22)27(29)30/h2-12,14-15,20-21,26,28H,13,16H2,1H3,(H,29,30)/t20-,21+,26-/m0/s1 |
| InChIKey | KGPOYMYHPINURS-UZINWLIJSA-N |
| XLogP | 6.81 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.57 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|