C26H23ClN2O2S — CID 126176598
(3aS,4S,9bS)-4-(2-chloro-5-nitrophenyl)-6-methyl-8-(phenylsulfanylmethyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline (PubChem CID 126176598) has the molecular formula C26H23ClN2O2S and a molecular weight of 463.00 g/mol. Its IUPAC name is (3aS,4S,9bS)-4-(2-chloro-5-nitrophenyl)-6-methyl-8-(phenylsulfanylmethyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline.
| Compound Name | (3aS,4S,9bS)-4-(2-chloro-5-nitrophenyl)-6-methyl-8-(phenylsulfanylmethyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
|---|---|
| PubChem CID | 126176598 |
| Molecular Formula | C26H23ClN2O2S |
| Molecular Weight | 463.00 g/mol |
| Exact Mass | 462.12 |
| IUPAC Name | (3aS,4S,9bS)-4-(2-chloro-5-nitrophenyl)-6-methyl-8-(phenylsulfanylmethyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
| SMILES | Cc1cc(CSc2ccccc2)cc2c1N[C@H](c1cc([N+](=O)[O-])ccc1Cl)[C@H]1CC=C[C@H]21 |
| InChI | InChI=1S/C26H23ClN2O2S/c1-16-12-17(15-32-19-6-3-2-4-7-19)13-22-20-8-5-9-21(20)26(28-25(16)22)23-14-18(29(30)31)10-11-24(23)27/h2-8,10-14,20-21,26,28H,9,15H2,1H3/t20-,21-,26-/m0/s1 |
| InChIKey | UILUKSUQJVHRCM-WOVHNISZSA-N |
| XLogP | 7.68 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.00 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|