C20H21NO2 — CID 126182240
(2R,6Z)-2-methyl-6-[(4-phenoxyanilino)methylidene]cyclohexan-1-one (PubChem CID 126182240) has the molecular formula C20H21NO2 and a molecular weight of 307.39 g/mol. Its IUPAC name is (2R,6Z)-2-methyl-6-[(4-phenoxyanilino)methylidene]cyclohexan-1-one.
| Compound Name | (2R,6Z)-2-methyl-6-[(4-phenoxyanilino)methylidene]cyclohexan-1-one |
|---|---|
| PubChem CID | 126182240 |
| Molecular Formula | C20H21NO2 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | (2R,6Z)-2-methyl-6-[(4-phenoxyanilino)methylidene]cyclohexan-1-one |
| SMILES | C[C@@H]1CCC/C(=C/Nc2ccc(Oc3ccccc3)cc2)C1=O |
| InChI | InChI=1S/C20H21NO2/c1-15-6-5-7-16(20(15)22)14-21-17-10-12-19(13-11-17)23-18-8-3-2-4-9-18/h2-4,8-15,21H,5-7H2,1H3/b16-14-/t15-/m1/s1 |
| InChIKey | GBDZLQBCXSYETA-VZHUHSAUSA-N |
| XLogP | 5.16 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|