C16H21NO2 — CID 6580830
(2Z,6S)-2-[[3-[(1R)-1-hydroxyethyl]anilino]methylidene]-6-methylcyclohexan-1-one (PubChem CID 6580830) has the molecular formula C16H21NO2 and a molecular weight of 259.35 g/mol. Its IUPAC name is (2Z,6S)-2-[[3-[(1R)-1-hydroxyethyl]anilino]methylidene]-6-methylcyclohexan-1-one.
| Compound Name | (2Z,6S)-2-[[3-[(1R)-1-hydroxyethyl]anilino]methylidene]-6-methylcyclohexan-1-one |
|---|---|
| PubChem CID | 6580830 |
| Molecular Formula | C16H21NO2 |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.16 |
| IUPAC Name | (2Z,6S)-2-[[3-[(1R)-1-hydroxyethyl]anilino]methylidene]-6-methylcyclohexan-1-one |
| SMILES | C[C@H]1CCC/C(=C/Nc2cccc([C@@H](C)O)c2)C1=O |
| InChI | InChI=1S/C16H21NO2/c1-11-5-3-7-14(16(11)19)10-17-15-8-4-6-13(9-15)12(2)18/h4,6,8-12,17-18H,3,5,7H2,1-2H3/b14-10-/t11-,12+/m0/s1 |
| InChIKey | IJYVNNWYCLWURB-BKATZTBISA-N |
| XLogP | 3.42 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|