C15H18ClNO — CID 126183052
(2Z,6R)-2-[(5-chloro-2-methylanilino)methylidene]-6-methylcyclohexan-1-one (PubChem CID 126183052) has the molecular formula C15H18ClNO and a molecular weight of 263.77 g/mol. Its IUPAC name is (2Z,6R)-2-[(5-chloro-2-methylanilino)methylidene]-6-methylcyclohexan-1-one.
| Compound Name | (2Z,6R)-2-[(5-chloro-2-methylanilino)methylidene]-6-methylcyclohexan-1-one |
|---|---|
| PubChem CID | 126183052 |
| Molecular Formula | C15H18ClNO |
| Molecular Weight | 263.77 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | (2Z,6R)-2-[(5-chloro-2-methylanilino)methylidene]-6-methylcyclohexan-1-one |
| SMILES | Cc1ccc(Cl)cc1N/C=C1/CCC[C@@H](C)C1=O |
| InChI | InChI=1S/C15H18ClNO/c1-10-6-7-13(16)8-14(10)17-9-12-5-3-4-11(2)15(12)18/h6-9,11,17H,3-5H2,1-2H3/b12-9-/t11-/m1/s1 |
| InChIKey | XKQMTPDGLWLPEV-ZGSOTFDTSA-N |
| XLogP | 4.33 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.77 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|