C27H26N2O4S — CID 126185421
2-[(5Z)-2,4-dioxo-5-[(2-propan-2-yloxynaphthalen-1-yl)methylidene]-1,3-thiazolidin-3-yl]-N-(4-ethylphenyl)acetamide (PubChem CID 126185421) has the molecular formula C27H26N2O4S and a molecular weight of 474.58 g/mol. Its IUPAC name is 2-[(5Z)-2,4-dioxo-5-[(2-propan-2-yloxynaphthalen-1-yl)methylidene]-1,3-thiazolidin-3-yl]-N-(4-ethylphenyl)acetamide.
| Compound Name | 2-[(5Z)-2,4-dioxo-5-[(2-propan-2-yloxynaphthalen-1-yl)methylidene]-1,3-thiazolidin-3-yl]-N-(4-ethylphenyl)acetamide |
|---|---|
| PubChem CID | 126185421 |
| Molecular Formula | C27H26N2O4S |
| Molecular Weight | 474.58 g/mol |
| Exact Mass | 474.16 |
| IUPAC Name | 2-[(5Z)-2,4-dioxo-5-[(2-propan-2-yloxynaphthalen-1-yl)methylidene]-1,3-thiazolidin-3-yl]-N-(4-ethylphenyl)acetamide |
| SMILES | CCc1ccc(NC(=O)CN2C(=O)S/C(=C\c3c(OC(C)C)ccc4ccccc34)C2=O)cc1 |
| InChI | InChI=1S/C27H26N2O4S/c1-4-18-9-12-20(13-10-18)28-25(30)16-29-26(31)24(34-27(29)32)15-22-21-8-6-5-7-19(21)11-14-23(22)33-17(2)3/h5-15,17H,4,16H2,1-3H3,(H,28,30)/b24-15- |
| InChIKey | KLLPJVAISJAJOM-IWIPYMOSSA-N |
| XLogP | 5.86 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.58 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|