C44H35I2N3O4S — CID 126190860
N-benzhydryl-2-[(5E)-5-[[3,5-diiodo-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-1-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-4,6-dioxopyrimidin-2-yl]sulfanylacetamide (PubChem CID 126190860) has the molecular formula C44H35I2N3O4S and a molecular weight of 955.66 g/mol. Its IUPAC name is N-benzhydryl-2-[(5E)-5-[[3,5-diiodo-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-1-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-4,6-dioxopyrimidin-2-yl]sulfanylacetamide.
| Compound Name | N-benzhydryl-2-[(5E)-5-[[3,5-diiodo-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-1-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-4,6-dioxopyrimidin-2-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 126190860 |
| Molecular Formula | C44H35I2N3O4S |
| Molecular Weight | 955.66 g/mol |
| Exact Mass | 955.04 |
| IUPAC Name | N-benzhydryl-2-[(5E)-5-[[3,5-diiodo-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-1-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-4,6-dioxopyrimidin-2-yl]sulfanylacetamide |
| SMILES | C=C/C=C\C(=C/C)N1C(=O)/C(=C/c2cc(I)c(OCc3cccc4ccccc34)c(I)c2)C(=O)N=C1SCC(=O)NC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C44H35I2N3O4S/c1-3-5-22-34(4-2)49-43(52)36(24-29-25-37(45)41(38(46)26-29)53-27-33-21-14-20-30-15-12-13-23-35(30)33)42(51)48-44(49)54-28-39(50)47-40(31-16-8-6-9-17-31)32-18-10-7-11-19-32/h3-26,40H,1,27-28H2,2H3,(H,47,50)/b22-5-,34-4+,36-24+ |
| InChIKey | HDMDICKWCURCIY-WWXXKSMJSA-N |
| XLogP | 10.02 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 955.66 |
| LogP ≤ 5 | 10.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|