C41H35Cl2N3O4S — CID 126191399
N-benzhydryl-2-[(5E)-5-[[3,5-dichloro-4-[(3-methylphenyl)methoxy]phenyl]methylidene]-1-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-4,6-dioxopyrimidin-2-yl]sulfanylacetamide (PubChem CID 126191399) has the molecular formula C41H35Cl2N3O4S and a molecular weight of 736.72 g/mol. Its IUPAC name is N-benzhydryl-2-[(5E)-5-[[3,5-dichloro-4-[(3-methylphenyl)methoxy]phenyl]methylidene]-1-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-4,6-dioxopyrimidin-2-yl]sulfanylacetamide.
| Compound Name | N-benzhydryl-2-[(5E)-5-[[3,5-dichloro-4-[(3-methylphenyl)methoxy]phenyl]methylidene]-1-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-4,6-dioxopyrimidin-2-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 126191399 |
| Molecular Formula | C41H35Cl2N3O4S |
| Molecular Weight | 736.72 g/mol |
| Exact Mass | 735.17 |
| IUPAC Name | N-benzhydryl-2-[(5E)-5-[[3,5-dichloro-4-[(3-methylphenyl)methoxy]phenyl]methylidene]-1-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-4,6-dioxopyrimidin-2-yl]sulfanylacetamide |
| SMILES | C=C/C=C\C(=C/C)N1C(=O)/C(=C/c2cc(Cl)c(OCc3cccc(C)c3)c(Cl)c2)C(=O)N=C1SCC(=O)NC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C41H35Cl2N3O4S/c1-4-6-20-32(5-2)46-40(49)33(22-29-23-34(42)38(35(43)24-29)50-25-28-15-13-14-27(3)21-28)39(48)45-41(46)51-26-36(47)44-37(30-16-9-7-10-17-30)31-18-11-8-12-19-31/h4-24,37H,1,25-26H2,2-3H3,(H,44,47)/b20-6-,32-5+,33-22+ |
| InChIKey | JUOCZWLNJBDRNC-IOSUBWPCSA-N |
| XLogP | 9.27 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 736.72 |
| LogP ≤ 5 | 9.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|