C35H29BrClN3O6S — CID 126189613
2-[4-[(E)-[2-[2-(benzhydrylamino)-2-oxoethyl]sulfanyl-1-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-4,6-dioxopyrimidin-5-ylidene]methyl]-2-bromo-6-chlorophenoxy]acetic acid (PubChem CID 126189613) has the molecular formula C35H29BrClN3O6S and a molecular weight of 735.06 g/mol. Its IUPAC name is 2-[4-[(E)-[2-[2-(benzhydrylamino)-2-oxoethyl]sulfanyl-1-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-4,6-dioxopyrimidin-5-ylidene]methyl]-2-bromo-6-chlorophenoxy]acetic acid.
| Compound Name | 2-[4-[(E)-[2-[2-(benzhydrylamino)-2-oxoethyl]sulfanyl-1-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-4,6-dioxopyrimidin-5-ylidene]methyl]-2-bromo-6-chlorophenoxy]acetic acid |
|---|---|
| PubChem CID | 126189613 |
| Molecular Formula | C35H29BrClN3O6S |
| Molecular Weight | 735.06 g/mol |
| Exact Mass | 733.06 |
| IUPAC Name | 2-[4-[(E)-[2-[2-(benzhydrylamino)-2-oxoethyl]sulfanyl-1-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-4,6-dioxopyrimidin-5-ylidene]methyl]-2-bromo-6-chlorophenoxy]acetic acid |
| SMILES | C=C/C=C\C(=C/C)N1C(=O)/C(=C/c2cc(Cl)c(OCC(=O)O)c(Br)c2)C(=O)N=C1SCC(=O)NC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C35H29BrClN3O6S/c1-3-5-16-25(4-2)40-34(45)26(17-22-18-27(36)32(28(37)19-22)46-20-30(42)43)33(44)39-35(40)47-21-29(41)38-31(23-12-8-6-9-13-23)24-14-10-7-11-15-24/h3-19,31H,1,20-21H2,2H3,(H,38,41)(H,42,43)/b16-5-,25-4+,26-17+ |
| InChIKey | BKWGWAPFJSABMU-NFSMCZRPSA-N |
| XLogP | 6.96 |
| TPSA | 125.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.06 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|