C34H29BrN4O6S — CID 126192129
N-benzhydryl-2-[(5E)-5-[(3-bromo-4-methoxy-5-nitrophenyl)methylidene]-1-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-4,6-dioxopyrimidin-2-yl]sulfanylacetamide (PubChem CID 126192129) has the molecular formula C34H29BrN4O6S and a molecular weight of 701.60 g/mol. Its IUPAC name is N-benzhydryl-2-[(5E)-5-[(3-bromo-4-methoxy-5-nitrophenyl)methylidene]-1-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-4,6-dioxopyrimidin-2-yl]sulfanylacetamide.
| Compound Name | N-benzhydryl-2-[(5E)-5-[(3-bromo-4-methoxy-5-nitrophenyl)methylidene]-1-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-4,6-dioxopyrimidin-2-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 126192129 |
| Molecular Formula | C34H29BrN4O6S |
| Molecular Weight | 701.60 g/mol |
| Exact Mass | 700.10 |
| IUPAC Name | N-benzhydryl-2-[(5E)-5-[(3-bromo-4-methoxy-5-nitrophenyl)methylidene]-1-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-4,6-dioxopyrimidin-2-yl]sulfanylacetamide |
| SMILES | C=C/C=C\C(=C/C)N1C(=O)/C(=C/c2cc(Br)c(OC)c([N+](=O)[O-])c2)C(=O)N=C1SCC(=O)NC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C34H29BrN4O6S/c1-4-6-17-25(5-2)38-33(42)26(18-22-19-27(35)31(45-3)28(20-22)39(43)44)32(41)37-34(38)46-21-29(40)36-30(23-13-9-7-10-14-23)24-15-11-8-12-16-24/h4-20,30H,1,21H2,2-3H3,(H,36,40)/b17-6-,25-5+,26-18+ |
| InChIKey | RUOBSCKHCYDVCA-QICITKFESA-N |
| XLogP | 6.76 |
| TPSA | 131.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.60 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|