C35H32BrN3O5S — CID 126192031
N-benzhydryl-2-[(5Z)-5-[(3-bromo-4,5-dimethoxyphenyl)methylidene]-1-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-4,6-dioxopyrimidin-2-yl]sulfanylacetamide (PubChem CID 126192031) has the molecular formula C35H32BrN3O5S and a molecular weight of 686.63 g/mol. Its IUPAC name is N-benzhydryl-2-[(5Z)-5-[(3-bromo-4,5-dimethoxyphenyl)methylidene]-1-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-4,6-dioxopyrimidin-2-yl]sulfanylacetamide.
| Compound Name | N-benzhydryl-2-[(5Z)-5-[(3-bromo-4,5-dimethoxyphenyl)methylidene]-1-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-4,6-dioxopyrimidin-2-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 126192031 |
| Molecular Formula | C35H32BrN3O5S |
| Molecular Weight | 686.63 g/mol |
| Exact Mass | 685.12 |
| IUPAC Name | N-benzhydryl-2-[(5Z)-5-[(3-bromo-4,5-dimethoxyphenyl)methylidene]-1-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-4,6-dioxopyrimidin-2-yl]sulfanylacetamide |
| SMILES | C=C/C=C\C(=C/C)N1C(=O)/C(=C\c2cc(Br)c(OC)c(OC)c2)C(=O)N=C1SCC(=O)NC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C35H32BrN3O5S/c1-5-7-18-26(6-2)39-34(42)27(19-23-20-28(36)32(44-4)29(21-23)43-3)33(41)38-35(39)45-22-30(40)37-31(24-14-10-8-11-15-24)25-16-12-9-13-17-25/h5-21,31H,1,22H2,2-4H3,(H,37,40)/b18-7-,26-6+,27-19- |
| InChIKey | PZWSZYVQKIUAFO-FFLVAILTSA-N |
| XLogP | 6.86 |
| TPSA | 97.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.63 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|