C36H34BrN3O5S — CID 126190282
N-benzhydryl-2-[(5E)-5-[(2-bromo-4-ethoxy-5-methoxyphenyl)methylidene]-1-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-4,6-dioxopyrimidin-2-yl]sulfanylacetamide (PubChem CID 126190282) has the molecular formula C36H34BrN3O5S and a molecular weight of 700.65 g/mol. Its IUPAC name is N-benzhydryl-2-[(5E)-5-[(2-bromo-4-ethoxy-5-methoxyphenyl)methylidene]-1-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-4,6-dioxopyrimidin-2-yl]sulfanylacetamide.
| Compound Name | N-benzhydryl-2-[(5E)-5-[(2-bromo-4-ethoxy-5-methoxyphenyl)methylidene]-1-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-4,6-dioxopyrimidin-2-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 126190282 |
| Molecular Formula | C36H34BrN3O5S |
| Molecular Weight | 700.65 g/mol |
| Exact Mass | 699.14 |
| IUPAC Name | N-benzhydryl-2-[(5E)-5-[(2-bromo-4-ethoxy-5-methoxyphenyl)methylidene]-1-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-4,6-dioxopyrimidin-2-yl]sulfanylacetamide |
| SMILES | C=C/C=C\C(=C/C)N1C(=O)/C(=C/c2cc(OC)c(OCC)cc2Br)C(=O)N=C1SCC(=O)NC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C36H34BrN3O5S/c1-5-8-19-27(6-2)40-35(43)28(20-26-21-30(44-4)31(45-7-3)22-29(26)37)34(42)39-36(40)46-23-32(41)38-33(24-15-11-9-12-16-24)25-17-13-10-14-18-25/h5-6,8-22,33H,1,7,23H2,2-4H3,(H,38,41)/b19-8-,27-6+,28-20+ |
| InChIKey | DUQZSRJIXLBOCY-BRBBWVIMSA-N |
| XLogP | 7.25 |
| TPSA | 97.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.65 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|