C33H28BrN3O3S — CID 126190446
N-benzhydryl-2-[(5E)-5-[(4-bromophenyl)methylidene]-1-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-4,6-dioxopyrimidin-2-yl]sulfanylacetamide (PubChem CID 126190446) has the molecular formula C33H28BrN3O3S and a molecular weight of 626.58 g/mol. Its IUPAC name is N-benzhydryl-2-[(5E)-5-[(4-bromophenyl)methylidene]-1-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-4,6-dioxopyrimidin-2-yl]sulfanylacetamide.
| Compound Name | N-benzhydryl-2-[(5E)-5-[(4-bromophenyl)methylidene]-1-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-4,6-dioxopyrimidin-2-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 126190446 |
| Molecular Formula | C33H28BrN3O3S |
| Molecular Weight | 626.58 g/mol |
| Exact Mass | 625.10 |
| IUPAC Name | N-benzhydryl-2-[(5E)-5-[(4-bromophenyl)methylidene]-1-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-4,6-dioxopyrimidin-2-yl]sulfanylacetamide |
| SMILES | C=C/C=C\C(=C/C)N1C(=O)/C(=C/c2ccc(Br)cc2)C(=O)N=C1SCC(=O)NC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C33H28BrN3O3S/c1-3-5-16-27(4-2)37-32(40)28(21-23-17-19-26(34)20-18-23)31(39)36-33(37)41-22-29(38)35-30(24-12-8-6-9-13-24)25-14-10-7-11-15-25/h3-21,30H,1,22H2,2H3,(H,35,38)/b16-5-,27-4+,28-21+ |
| InChIKey | FNQFCBYSXHDDFU-FMWYSGSYSA-N |
| XLogP | 6.84 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.58 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|