C31H27N3O4S — CID 126191912
N-benzhydryl-2-[(5E)-5-(furan-2-ylmethylidene)-1-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-4,6-dioxopyrimidin-2-yl]sulfanylacetamide (PubChem CID 126191912) has the molecular formula C31H27N3O4S and a molecular weight of 537.64 g/mol. Its IUPAC name is N-benzhydryl-2-[(5E)-5-(furan-2-ylmethylidene)-1-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-4,6-dioxopyrimidin-2-yl]sulfanylacetamide.
| Compound Name | N-benzhydryl-2-[(5E)-5-(furan-2-ylmethylidene)-1-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-4,6-dioxopyrimidin-2-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 126191912 |
| Molecular Formula | C31H27N3O4S |
| Molecular Weight | 537.64 g/mol |
| Exact Mass | 537.17 |
| IUPAC Name | N-benzhydryl-2-[(5E)-5-(furan-2-ylmethylidene)-1-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-4,6-dioxopyrimidin-2-yl]sulfanylacetamide |
| SMILES | C=C/C=C\C(=C/C)N1C(=O)/C(=C/c2ccco2)C(=O)N=C1SCC(=O)NC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H27N3O4S/c1-3-5-17-24(4-2)34-30(37)26(20-25-18-12-19-38-25)29(36)33-31(34)39-21-27(35)32-28(22-13-8-6-9-14-22)23-15-10-7-11-16-23/h3-20,28H,1,21H2,2H3,(H,32,35)/b17-5-,24-4+,26-20+ |
| InChIKey | OFYTWDPNAVYCHT-YJSHLOSGSA-N |
| XLogP | 5.67 |
| TPSA | 91.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.64 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|