C35H30N4O4S — CID 126192282
N-benzhydryl-2-[(5E)-5-[[4-(cyanomethoxy)phenyl]methylidene]-1-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-4,6-dioxopyrimidin-2-yl]sulfanylacetamide (PubChem CID 126192282) has the molecular formula C35H30N4O4S and a molecular weight of 602.72 g/mol. Its IUPAC name is N-benzhydryl-2-[(5E)-5-[[4-(cyanomethoxy)phenyl]methylidene]-1-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-4,6-dioxopyrimidin-2-yl]sulfanylacetamide.
| Compound Name | N-benzhydryl-2-[(5E)-5-[[4-(cyanomethoxy)phenyl]methylidene]-1-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-4,6-dioxopyrimidin-2-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 126192282 |
| Molecular Formula | C35H30N4O4S |
| Molecular Weight | 602.72 g/mol |
| Exact Mass | 602.20 |
| IUPAC Name | N-benzhydryl-2-[(5E)-5-[[4-(cyanomethoxy)phenyl]methylidene]-1-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-4,6-dioxopyrimidin-2-yl]sulfanylacetamide |
| SMILES | C=C/C=C\C(=C/C)N1C(=O)/C(=C/c2ccc(OCC#N)cc2)C(=O)N=C1SCC(=O)NC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C35H30N4O4S/c1-3-5-16-28(4-2)39-34(42)30(23-25-17-19-29(20-18-25)43-22-21-36)33(41)38-35(39)44-24-31(40)37-32(26-12-8-6-9-13-26)27-14-10-7-11-15-27/h3-20,23,32H,1,22,24H2,2H3,(H,37,40)/b16-5-,28-4+,30-23+ |
| InChIKey | VPCORXNGPHEKLH-QSRQKLKJSA-N |
| XLogP | 5.98 |
| TPSA | 111.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.72 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|