C40H34BrN3O4S — CID 126189999
N-benzhydryl-2-[(5E)-5-[[4-[(4-bromophenyl)methoxy]phenyl]methylidene]-1-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-4,6-dioxopyrimidin-2-yl]sulfanylacetamide (PubChem CID 126189999) has the molecular formula C40H34BrN3O4S and a molecular weight of 732.70 g/mol. Its IUPAC name is N-benzhydryl-2-[(5E)-5-[[4-[(4-bromophenyl)methoxy]phenyl]methylidene]-1-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-4,6-dioxopyrimidin-2-yl]sulfanylacetamide.
| Compound Name | N-benzhydryl-2-[(5E)-5-[[4-[(4-bromophenyl)methoxy]phenyl]methylidene]-1-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-4,6-dioxopyrimidin-2-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 126189999 |
| Molecular Formula | C40H34BrN3O4S |
| Molecular Weight | 732.70 g/mol |
| Exact Mass | 731.15 |
| IUPAC Name | N-benzhydryl-2-[(5E)-5-[[4-[(4-bromophenyl)methoxy]phenyl]methylidene]-1-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-4,6-dioxopyrimidin-2-yl]sulfanylacetamide |
| SMILES | C=C/C=C\C(=C/C)N1C(=O)/C(=C/c2ccc(OCc3ccc(Br)cc3)cc2)C(=O)N=C1SCC(=O)NC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C40H34BrN3O4S/c1-3-5-16-33(4-2)44-39(47)35(25-28-19-23-34(24-20-28)48-26-29-17-21-32(41)22-18-29)38(46)43-40(44)49-27-36(45)42-37(30-12-8-6-9-13-30)31-14-10-7-11-15-31/h3-25,37H,1,26-27H2,2H3,(H,42,45)/b16-5-,33-4+,35-25+ |
| InChIKey | DGCHNVKRWCEFPX-VJJKPSKZSA-N |
| XLogP | 8.42 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.70 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|