C41H34BrN3O6S — CID 126192443
4-[[2-[(E)-[2-[2-(benzhydrylamino)-2-oxoethyl]sulfanyl-1-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-4,6-dioxopyrimidin-5-ylidene]methyl]-4-bromophenoxy]methyl]benzoic acid (PubChem CID 126192443) has the molecular formula C41H34BrN3O6S and a molecular weight of 776.71 g/mol. Its IUPAC name is 4-[[2-[(E)-[2-[2-(benzhydrylamino)-2-oxoethyl]sulfanyl-1-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-4,6-dioxopyrimidin-5-ylidene]methyl]-4-bromophenoxy]methyl]benzoic acid.
| Compound Name | 4-[[2-[(E)-[2-[2-(benzhydrylamino)-2-oxoethyl]sulfanyl-1-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-4,6-dioxopyrimidin-5-ylidene]methyl]-4-bromophenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 126192443 |
| Molecular Formula | C41H34BrN3O6S |
| Molecular Weight | 776.71 g/mol |
| Exact Mass | 775.14 |
| IUPAC Name | 4-[[2-[(E)-[2-[2-(benzhydrylamino)-2-oxoethyl]sulfanyl-1-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-4,6-dioxopyrimidin-5-ylidene]methyl]-4-bromophenoxy]methyl]benzoic acid |
| SMILES | C=C/C=C\C(=C/C)N1C(=O)/C(=C/c2cc(Br)ccc2OCc2ccc(C(=O)O)cc2)C(=O)N=C1SCC(=O)NC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C41H34BrN3O6S/c1-3-5-16-33(4-2)45-39(48)34(24-31-23-32(42)21-22-35(31)51-25-27-17-19-30(20-18-27)40(49)50)38(47)44-41(45)52-26-36(46)43-37(28-12-8-6-9-13-28)29-14-10-7-11-15-29/h3-24,37H,1,25-26H2,2H3,(H,43,46)(H,49,50)/b16-5-,33-4+,34-24+ |
| InChIKey | YKNJKFQGDCFXHY-ISMPAJQOSA-N |
| XLogP | 8.12 |
| TPSA | 125.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 776.71 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|