C36H30BrN3O4S — CID 126192145
N-benzhydryl-2-[(5E)-5-[(3-bromo-4-prop-2-ynoxyphenyl)methylidene]-1-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-4,6-dioxopyrimidin-2-yl]sulfanylacetamide (PubChem CID 126192145) has the molecular formula C36H30BrN3O4S and a molecular weight of 680.62 g/mol. Its IUPAC name is N-benzhydryl-2-[(5E)-5-[(3-bromo-4-prop-2-ynoxyphenyl)methylidene]-1-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-4,6-dioxopyrimidin-2-yl]sulfanylacetamide.
| Compound Name | N-benzhydryl-2-[(5E)-5-[(3-bromo-4-prop-2-ynoxyphenyl)methylidene]-1-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-4,6-dioxopyrimidin-2-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 126192145 |
| Molecular Formula | C36H30BrN3O4S |
| Molecular Weight | 680.62 g/mol |
| Exact Mass | 679.11 |
| IUPAC Name | N-benzhydryl-2-[(5E)-5-[(3-bromo-4-prop-2-ynoxyphenyl)methylidene]-1-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-4,6-dioxopyrimidin-2-yl]sulfanylacetamide |
| SMILES | C#CCOc1ccc(/C=C2\C(=O)N=C(SCC(=O)NC(c3ccccc3)c3ccccc3)N(C(/C=C\C=C)=C/C)C2=O)cc1Br |
| InChI | InChI=1S/C36H30BrN3O4S/c1-4-7-18-28(6-3)40-35(43)29(22-25-19-20-31(30(37)23-25)44-21-5-2)34(42)39-36(40)45-24-32(41)38-33(26-14-10-8-11-15-26)27-16-12-9-13-17-27/h2,4,6-20,22-23,33H,1,21,24H2,3H3,(H,38,41)/b18-7-,28-6+,29-22+ |
| InChIKey | SAQFRDBLUWSWFX-JXJWDXPYSA-N |
| XLogP | 6.85 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.62 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|