C39H38BrN3O7S — CID 126190057
ethyl 2-[4-[(E)-[2-[2-(benzhydrylamino)-2-oxoethyl]sulfanyl-1-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-4,6-dioxopyrimidin-5-ylidene]methyl]-5-bromo-2-ethoxyphenoxy]acetate (PubChem CID 126190057) has the molecular formula C39H38BrN3O7S and a molecular weight of 772.72 g/mol. Its IUPAC name is ethyl 2-[4-[(E)-[2-[2-(benzhydrylamino)-2-oxoethyl]sulfanyl-1-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-4,6-dioxopyrimidin-5-ylidene]methyl]-5-bromo-2-ethoxyphenoxy]acetate.
| Compound Name | ethyl 2-[4-[(E)-[2-[2-(benzhydrylamino)-2-oxoethyl]sulfanyl-1-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-4,6-dioxopyrimidin-5-ylidene]methyl]-5-bromo-2-ethoxyphenoxy]acetate |
|---|---|
| PubChem CID | 126190057 |
| Molecular Formula | C39H38BrN3O7S |
| Molecular Weight | 772.72 g/mol |
| Exact Mass | 771.16 |
| IUPAC Name | ethyl 2-[4-[(E)-[2-[2-(benzhydrylamino)-2-oxoethyl]sulfanyl-1-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-4,6-dioxopyrimidin-5-ylidene]methyl]-5-bromo-2-ethoxyphenoxy]acetate |
| SMILES | C=C/C=C\C(=C/C)N1C(=O)/C(=C/c2cc(OCC)c(OCC(=O)OCC)cc2Br)C(=O)N=C1SCC(=O)NC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C39H38BrN3O7S/c1-5-9-20-29(6-2)43-38(47)30(21-28-22-32(48-7-3)33(23-31(28)40)50-24-35(45)49-8-4)37(46)42-39(43)51-25-34(44)41-36(26-16-12-10-13-17-26)27-18-14-11-15-19-27/h5-6,9-23,36H,1,7-8,24-25H2,2-4H3,(H,41,44)/b20-9-,29-6+,30-21+ |
| InChIKey | STHUMLYISNWFTQ-WUZIEQONSA-N |
| XLogP | 7.18 |
| TPSA | 123.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 772.72 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|