C37H35N3O6S — CID 126190612
ethyl 2-[2-[(E)-[2-[2-(benzhydrylamino)-2-oxoethyl]sulfanyl-1-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-4,6-dioxopyrimidin-5-ylidene]methyl]phenoxy]acetate (PubChem CID 126190612) has the molecular formula C37H35N3O6S and a molecular weight of 649.77 g/mol. Its IUPAC name is ethyl 2-[2-[(E)-[2-[2-(benzhydrylamino)-2-oxoethyl]sulfanyl-1-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-4,6-dioxopyrimidin-5-ylidene]methyl]phenoxy]acetate.
| Compound Name | ethyl 2-[2-[(E)-[2-[2-(benzhydrylamino)-2-oxoethyl]sulfanyl-1-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-4,6-dioxopyrimidin-5-ylidene]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 126190612 |
| Molecular Formula | C37H35N3O6S |
| Molecular Weight | 649.77 g/mol |
| Exact Mass | 649.22 |
| IUPAC Name | ethyl 2-[2-[(E)-[2-[2-(benzhydrylamino)-2-oxoethyl]sulfanyl-1-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-4,6-dioxopyrimidin-5-ylidene]methyl]phenoxy]acetate |
| SMILES | C=C/C=C\C(=C/C)N1C(=O)/C(=C/c2ccccc2OCC(=O)OCC)C(=O)N=C1SCC(=O)NC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C37H35N3O6S/c1-4-7-21-29(5-2)40-36(44)30(23-28-20-14-15-22-31(28)46-24-33(42)45-6-3)35(43)39-37(40)47-25-32(41)38-34(26-16-10-8-11-17-26)27-18-12-9-13-19-27/h4-5,7-23,34H,1,6,24-25H2,2-3H3,(H,38,41)/b21-7-,29-5+,30-23+ |
| InChIKey | GFWXXVPFJUXFJC-ZVRQFFJGSA-N |
| XLogP | 6.02 |
| TPSA | 114.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.77 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|