C24H15Br2FN2O4 — CID 126194332
(5E)-5-[[4-[(2,4-dibromophenyl)methoxy]phenyl]methylidene]-1-(2-fluorophenyl)-1,3-diazinane-2,4,6-trione (PubChem CID 126194332) has the molecular formula C24H15Br2FN2O4 and a molecular weight of 574.20 g/mol. Its IUPAC name is (5E)-5-[[4-[(2,4-dibromophenyl)methoxy]phenyl]methylidene]-1-(2-fluorophenyl)-1,3-diazinane-2,4,6-trione.
| Compound Name | (5E)-5-[[4-[(2,4-dibromophenyl)methoxy]phenyl]methylidene]-1-(2-fluorophenyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 126194332 |
| Molecular Formula | C24H15Br2FN2O4 |
| Molecular Weight | 574.20 g/mol |
| Exact Mass | 571.94 |
| IUPAC Name | (5E)-5-[[4-[(2,4-dibromophenyl)methoxy]phenyl]methylidene]-1-(2-fluorophenyl)-1,3-diazinane-2,4,6-trione |
| SMILES | O=C1NC(=O)N(c2ccccc2F)C(=O)/C1=C/c1ccc(OCc2ccc(Br)cc2Br)cc1 |
| InChI | InChI=1S/C24H15Br2FN2O4/c25-16-8-7-15(19(26)12-16)13-33-17-9-5-14(6-10-17)11-18-22(30)28-24(32)29(23(18)31)21-4-2-1-3-20(21)27/h1-12H,13H2,(H,28,30,32)/b18-11+ |
| InChIKey | WXQHNWWAFYFMOL-WOJGMQOQSA-N |
| XLogP | 5.60 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.20 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|