C23H19N3O5S — CID 126194439
(2S)-2-[5-[(E)-[1-(4-methoxyphenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]indol-1-yl]propanoic acid (PubChem CID 126194439) has the molecular formula C23H19N3O5S and a molecular weight of 449.49 g/mol. Its IUPAC name is (2S)-2-[5-[(E)-[1-(4-methoxyphenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]indol-1-yl]propanoic acid.
| Compound Name | (2S)-2-[5-[(E)-[1-(4-methoxyphenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]indol-1-yl]propanoic acid |
|---|---|
| PubChem CID | 126194439 |
| Molecular Formula | C23H19N3O5S |
| Molecular Weight | 449.49 g/mol |
| Exact Mass | 449.10 |
| IUPAC Name | (2S)-2-[5-[(E)-[1-(4-methoxyphenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]indol-1-yl]propanoic acid |
| SMILES | COc1ccc(N2C(=O)/C(=C/c3ccc4c(ccn4[C@@H](C)C(=O)O)c3)C(=O)NC2=S)cc1 |
| InChI | InChI=1S/C23H19N3O5S/c1-13(22(29)30)25-10-9-15-11-14(3-8-19(15)25)12-18-20(27)24-23(32)26(21(18)28)16-4-6-17(31-2)7-5-16/h3-13H,1-2H3,(H,29,30)(H,24,27,32)/b18-12+/t13-/m0/s1 |
| InChIKey | BPCPLIFISGFVQV-HTMJNSLASA-N |
| XLogP | 3.13 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.49 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|