C22H15Cl2N3O5 — CID 126198830
(2R)-2-[5-[(E)-[1-(2,3-dichlorophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]indol-1-yl]propanoic acid (PubChem CID 126198830) has the molecular formula C22H15Cl2N3O5 and a molecular weight of 472.28 g/mol. Its IUPAC name is (2R)-2-[5-[(E)-[1-(2,3-dichlorophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]indol-1-yl]propanoic acid.
| Compound Name | (2R)-2-[5-[(E)-[1-(2,3-dichlorophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]indol-1-yl]propanoic acid |
|---|---|
| PubChem CID | 126198830 |
| Molecular Formula | C22H15Cl2N3O5 |
| Molecular Weight | 472.28 g/mol |
| Exact Mass | 471.04 |
| IUPAC Name | (2R)-2-[5-[(E)-[1-(2,3-dichlorophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]indol-1-yl]propanoic acid |
| SMILES | C[C@H](C(=O)O)n1ccc2cc(/C=C3\C(=O)NC(=O)N(c4cccc(Cl)c4Cl)C3=O)ccc21 |
| InChI | InChI=1S/C22H15Cl2N3O5/c1-11(21(30)31)26-8-7-13-9-12(5-6-16(13)26)10-14-19(28)25-22(32)27(20(14)29)17-4-2-3-15(23)18(17)24/h2-11H,1H3,(H,30,31)(H,25,28,32)/b14-10+/t11-/m1/s1 |
| InChIKey | ZAZWVLPRSNLSFM-ZTMOJVSCSA-N |
| XLogP | 4.26 |
| TPSA | 108.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.28 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|