C15H13BrN2O4 — CID 126195999
(5E)-5-[(2-bromo-5-methoxy-4-prop-2-ynoxyphenyl)methylidene]-3-methylimidazolidine-2,4-dione (PubChem CID 126195999) has the molecular formula C15H13BrN2O4 and a molecular weight of 365.18 g/mol. Its IUPAC name is (5E)-5-[(2-bromo-5-methoxy-4-prop-2-ynoxyphenyl)methylidene]-3-methylimidazolidine-2,4-dione.
| Compound Name | (5E)-5-[(2-bromo-5-methoxy-4-prop-2-ynoxyphenyl)methylidene]-3-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 126195999 |
| Molecular Formula | C15H13BrN2O4 |
| Molecular Weight | 365.18 g/mol |
| Exact Mass | 364.01 |
| IUPAC Name | (5E)-5-[(2-bromo-5-methoxy-4-prop-2-ynoxyphenyl)methylidene]-3-methylimidazolidine-2,4-dione |
| SMILES | C#CCOc1cc(Br)c(/C=C2/NC(=O)N(C)C2=O)cc1OC |
| InChI | InChI=1S/C15H13BrN2O4/c1-4-5-22-13-8-10(16)9(7-12(13)21-3)6-11-14(19)18(2)15(20)17-11/h1,6-8H,5H2,2-3H3,(H,17,20)/b11-6+ |
| InChIKey | SKLUIHRAWSWJFR-IZZDOVSWSA-N |
| XLogP | 1.99 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.18 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|